CAS 1219979-90-4

Piperidine, 4-[(4-chloro-3-ethylphenoxy)methyl]-, hydrochloride (1:1)

Description:

Piperidine, 4-[(4-chloro-3-ethylphenoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The compound features a 4-chloro-3-ethylphenoxy group attached to the piperidine ring, indicating the presence of a chloro-substituted aromatic moiety that contributes to its chemical properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the chloro and ethyl groups may influence its biological activity and interaction with receptors or enzymes. This compound may exhibit properties such as moderate to high polarity, making it suitable for various chemical reactions and applications in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.

Formula: C₁₄H₂₀ClNO·ClH

InChI: InChI=1S/C14H20ClNO.ClH/c1-2-12-9-13(3-4-14(12)15)17-10-11-5-7-16-8-6-11;/h3-4,9,11,16H,2,5-8,10H2,1H3;1H

InChI key: InChIKey=OYMPDNAZKKEOAI-UHFFFAOYSA-N

SMILES: O(CC1CCNCC1)C2=CC(CC)=C(Cl)C=C2.Cl

Synonyms:

• Piperidine, 4-[(4-chloro-3-ethylphenoxy)methyl]-, hydrochloride (1:1)