CAS 1219979-93-7

Piperidine, 3-[2-(2-cyclohexylethoxy)ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 3-[2-(2-cyclohexylethoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a substituent that includes a cyclohexyl group linked through an ethoxy chain, contributing to its unique properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents, making it useful in various applications, including pharmaceuticals and organic synthesis. The presence of the piperidine moiety suggests potential biological activity, as piperidine derivatives are often explored for their pharmacological properties. The compound's molecular structure may influence its interaction with biological targets, potentially affecting its efficacy and safety profile. Additionally, the hydrochloride form can impact the compound's stability and handling characteristics, making it important for researchers to consider these factors in experimental designs and applications. Overall, this compound represents a specific class of piperidine derivatives with potential utility in medicinal chemistry.

Formula: C₁₅H₂₉NO·ClH

InChI: InChI=1S/C15H29NO.ClH/c1-2-5-14(6-3-1)8-11-17-12-9-15-7-4-10-16-13-15;/h14-16H,1-13H2;1H

InChI key: InChIKey=UHUMFPFNUVXFQF-UHFFFAOYSA-N

SMILES: C(COCCC1CCCNC1)C2CCCCC2.Cl

Synonyms:

• Piperidine, 3-[2-(2-cyclohexylethoxy)ethyl]-, hydrochloride (1:1)