CAS 1219980-02-5
:3-[(4-Methoxyphenyl)methoxy]azetidine
Description:
3-[(4-Methoxyphenyl)methoxy]azetidine is a chemical compound characterized by its azetidine ring, which is a four-membered saturated heterocyclic structure containing one nitrogen atom. The compound features a methoxy group attached to a phenyl ring, which enhances its lipophilicity and may influence its biological activity. The presence of the methoxy substituent on the phenyl ring can affect the compound's electronic properties and steric hindrance, potentially impacting its reactivity and interactions with biological targets. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas where azetidine derivatives are explored for therapeutic effects. As with many organic compounds, the solubility, stability, and reactivity of 3-[(4-Methoxyphenyl)methoxy]azetidine can vary based on environmental conditions and the presence of other chemical species. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C11H15NO2
InChI:InChI=1S/C11H15NO2/c1-13-10-4-2-9(3-5-10)8-14-11-6-12-7-11/h2-5,11-12H,6-8H2,1H3
InChI key:InChIKey=YJUVUYMZTANBRB-UHFFFAOYSA-N
SMILES:C(OC1CNC1)C2=CC=C(OC)C=C2
Synonyms:- 3-[(4-Methoxyphenyl)methoxy]azetidine
- Azetidine, 3-[(4-methoxyphenyl)methoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
