
CAS 1219980-05-8
:2H-Pyran-4-carboxylic acid, tetrahydro-, 4-piperidinylmethyl ester, hydrochloride (1:1)
Description:
2H-Pyran-4-carboxylic acid, tetrahydro-, 4-piperidinylmethyl ester, hydrochloride (1:1) is a chemical compound characterized by its pyran ring structure, which is a six-membered heterocyclic compound containing one oxygen atom. This substance features a carboxylic acid functional group and an ester linkage, indicating potential reactivity and solubility in polar solvents. The presence of the piperidine moiety suggests that it may exhibit basic properties and can participate in various chemical reactions, including nucleophilic substitutions. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its bioavailability for pharmaceutical applications. The compound may have implications in medicinal chemistry, particularly in the development of therapeutic agents, due to its structural features that can interact with biological targets. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Further studies would be necessary to fully elucidate its properties, potential applications, and biological activity.
Formula:C12H21NO3·ClH
InChI:InChI=1S/C12H21NO3.ClH/c14-12(11-3-7-15-8-4-11)16-9-10-1-5-13-6-2-10;/h10-11,13H,1-9H2;1H
InChI key:InChIKey=KKAQGBVPRYPALN-UHFFFAOYSA-N
SMILES:C(OCC1CCNCC1)(=O)C2CCOCC2.Cl
Synonyms:- 2H-Pyran-4-carboxylic acid, tetrahydro-, 4-piperidinylmethyl ester, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.