CAS 1219980-06-9

Pyrrolidine, 3-(2-phenoxyethoxy)-, hydrochloride (1:1)

Description:

Pyrrolidine, 3-(2-phenoxyethoxy)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered saturated heterocycle containing one nitrogen atom. This compound features a phenoxyethoxy substituent, contributing to its potential applications in medicinal chemistry and pharmacology. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its bioavailability. The presence of the phenoxy group may impart specific biological activities, making it of interest in drug development. The compound's molecular interactions, stability, and reactivity can be influenced by the functional groups present, which may also affect its pharmacokinetic properties. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Overall, this compound's unique structure and properties make it a subject of interest for further research and potential therapeutic applications.

Formula: C₁₂H₁₇NO₂·ClH

InChI: InChI=1S/C12H17NO2.ClH/c1-2-4-11(5-3-1)14-8-9-15-12-6-7-13-10-12;/h1-5,12-13H,6-10H2;1H

InChI key: InChIKey=UGTSNPIHXJBNAZ-UHFFFAOYSA-N

SMILES: O(CCOC1CCNC1)C2=CC=CC=C2.Cl

Synonyms:

• Pyrrolidine, 3-(2-phenoxyethoxy)-, hydrochloride (1:1)