CymitQuimica logo

CAS 1219980-59-2

:

3-Pyrrolidinamine, N-cyclohexyl-N-ethyl-, hydrochloride (1:2)

Description:
3-Pyrrolidinamine, N-cyclohexyl-N-ethyl-, hydrochloride (1:2) is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This substance features two alkyl substituents: a cyclohexyl group and an ethyl group, both attached to the nitrogen atom of the pyrrolidine. The hydrochloride designation indicates that the compound is in its salt form, which typically enhances its solubility in water and stability. As a hydrochloride salt, it is likely to exhibit properties such as increased hygroscopicity and improved handling characteristics compared to its free base form. The compound may be of interest in various fields, including medicinal chemistry and pharmacology, due to its potential biological activity. However, specific data regarding its toxicity, pharmacokinetics, and therapeutic applications would require further investigation. As with any chemical substance, proper safety protocols should be followed when handling it in a laboratory setting.
Formula:C12H24N2·2ClH
InChI:InChI=1S/C12H24N2.2ClH/c1-2-14(12-8-9-13-10-12)11-6-4-3-5-7-11;;/h11-13H,2-10H2,1H3;2*1H
InChI key:InChIKey=UTXGXXLBYGJPPA-UHFFFAOYSA-N
SMILES:N(CC)(C1CCCCC1)C2CCNC2.Cl
Synonyms:
  • 3-Pyrrolidinamine, N-cyclohexyl-N-ethyl-, hydrochloride (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.