
CAS 1219980-63-8
:2-Piperidineethanamine, N,N-diethyl-, hydrochloride (1:2)
Description:
2-Piperidineethanamine, N,N-diethyl-, hydrochloride (1:2) is a chemical compound characterized by its piperidine and ethylamine functional groups. It is a salt formed by the combination of the base 2-piperidineethanamine with hydrochloric acid, resulting in a hydrochloride form that enhances its solubility in water. This compound typically appears as a white crystalline solid and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the piperidine ring contributes to its basicity and ability to interact with biological systems, making it a subject of interest in drug design. Its molecular structure allows for various interactions with receptors and enzymes, which can influence its pharmacological properties. As with many amines, it may exhibit basicity and can form complexes with acids, impacting its behavior in different chemical environments. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C11H24N2·2ClH
InChI:InChI=1S/C11H24N2.2ClH/c1-3-13(4-2)10-8-11-7-5-6-9-12-11;;/h11-12H,3-10H2,1-2H3;2*1H
InChI key:InChIKey=VYYRFELMMHOYEE-UHFFFAOYSA-N
SMILES:C(CN(CC)CC)C1CCCCN1.Cl
Synonyms:- 2-Piperidineethanamine, N,N-diethyl-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.