
CAS 1219980-64-9
:Cyclopropanecarboxylic acid, 3-piperidinylmethyl ester, hydrochloride (1:1)
Description:
Cyclopropanecarboxylic acid, 3-piperidinylmethyl ester, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a piperidine moiety. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols due to the presence of the hydrochloride salt form. The piperidine group contributes to its basicity and potential biological activity, making it of interest in medicinal chemistry. The cyclopropanecarboxylic acid component may impart specific reactivity and stability characteristics, influencing its behavior in chemical reactions. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. This compound may be utilized in various applications, including pharmaceuticals and organic synthesis, where its unique structural features can be exploited for specific interactions or reactions. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C10H17NO2·ClH
InChI:InChI=1S/C10H17NO2.ClH/c12-10(9-3-4-9)13-7-8-2-1-5-11-6-8;/h8-9,11H,1-7H2;1H
InChI key:InChIKey=USHQSNQNVRMJQL-UHFFFAOYSA-N
SMILES:C(OCC1CCCNC1)(=O)C2CC2.Cl
Synonyms:- Cyclopropanecarboxylic acid, 3-piperidinylmethyl ester, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.