CAS 1219980-69-4

Piperidine, 4-methyl-1-[2-(2-piperidinyl)ethyl]-, hydrochloride (1:2)

Description:

Piperidine, 4-methyl-1-[2-(2-piperidinyl)ethyl]-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. This compound features a methyl group at the 4-position and a side chain that includes an ethyl group with an additional piperidine moiety, contributing to its complex structure. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents. The presence of multiple piperidine units suggests potential biological activity, making it of interest in medicinal chemistry and pharmacology. Its properties may include basicity due to the nitrogen atom, allowing it to form salts with acids. The compound's specific applications and effects would depend on its interaction with biological systems, which could involve neurotransmitter modulation or other pharmacological activities. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.

Formula: C₁₃H₂₆N₂·2ClH

InChI: InChI=1S/C13H26N2.2ClH/c1-12-5-9-15(10-6-12)11-7-13-4-2-3-8-14-13;;/h12-14H,2-11H2,1H3;2*1H

InChI key: InChIKey=SXMIZKJOBABDND-UHFFFAOYSA-N

SMILES: C(CC1CCCCN1)N2CCC(C)CC2.Cl

Synonyms:

• Piperidine, 4-methyl-1-[2-(2-piperidinyl)ethyl]-, hydrochloride (1:2)