CymitQuimica logo

CAS 1219980-70-7

:

6-Chloro-N-ethyl-N-(phenylmethyl)-4-pyrimidinamine

Description:
6-Chloro-N-ethyl-N-(phenylmethyl)-4-pyrimidinamine is a chemical compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing nitrogen atoms. The presence of a chloro group at the 6-position and an ethyl group along with a phenylmethyl substituent at the nitrogen atoms contributes to its unique chemical properties. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic phenylmethyl group, which can influence its solubility and permeability in biological systems. The chloro substituent may also impart specific reactivity, making it a potential candidate for various chemical reactions or applications in medicinal chemistry. Additionally, the structural features suggest potential interactions with biological targets, which could be explored for therapeutic purposes. Overall, the compound's characteristics, including its molecular structure and substituents, position it as a subject of interest in the fields of organic synthesis and pharmacology.
Formula:C13H14ClN3
InChI:InChI=1S/C13H14ClN3/c1-2-17(9-11-6-4-3-5-7-11)13-8-12(14)15-10-16-13/h3-8,10H,2,9H2,1H3
InChI key:InChIKey=KLMMVOBTDDPHEY-UHFFFAOYSA-N
SMILES:N(CC1=CC=CC=C1)(CC)C=2C=C(Cl)N=CN2
Synonyms:
  • 4-Pyrimidinamine, 6-chloro-N-ethyl-N-(phenylmethyl)-
  • 6-Chloro-N-ethyl-N-(phenylmethyl)-4-pyrimidinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.