CAS 1219980-73-0

Pyrrolidine, 3-[(3,4-dichlorophenoxy)methyl]-, hydrochloride (1:1)

Description:

Pyrrolidine, 3-[(3,4-dichlorophenoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of the 3,4-dichlorophenoxy group indicates that the compound has a phenoxy substituent with two chlorine atoms on the aromatic ring, contributing to its biological activity and potential pharmacological properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in medicinal chemistry. The compound may exhibit properties such as being a potential intermediate in the synthesis of pharmaceuticals or agrochemicals. Its specific interactions, stability, and reactivity would depend on the functional groups present and the overall molecular structure. Safety data and handling precautions should be considered, as with any chemical substance, particularly due to the presence of chlorine substituents, which can influence toxicity and environmental impact.

Formula: C₁₁H₁₄Cl₃NO

InChI: InChI=1S/C11H13Cl2NO.ClH/c12-10-2-1-9(5-11(10)13)15-7-8-3-4-14-6-8;/h1-2,5,8,14H,3-4,6-7H2;1H

InChI key: InChIKey=YIHTZADULYBTSS-UHFFFAOYSA-N

SMILES: O(CC1CCNC1)C2=CC(Cl)=C(Cl)C=C2.Cl

Synonyms:

• Pyrrolidine, 3-[(3,4-dichlorophenoxy)methyl]-, hydrochloride (1:1)
• 3-[(3,4-Dichlorophenoxy)methyl]pyrrolidinehydrochloride