
CAS 1219980-89-8
:Cyclopentanecarboxylic acid, 2-(3-piperidinyl)ethyl ester, hydrochloride (1:1)
Description:
Cyclopentanecarboxylic acid, 2-(3-piperidinyl)ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its ester functional group derived from cyclopentanecarboxylic acid and a piperidine moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The piperidine ring contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound may exhibit properties such as moderate lipophilicity, which can influence its pharmacokinetics and bioavailability. Its hydrochloride form indicates that it is a salt, which can affect its stability and handling characteristics. As with many compounds containing both carboxylic acid and amine functionalities, it may participate in various chemical reactions, including esterification and amide formation. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings.
Formula:C13H23NO2·ClH
InChI:InChI=1S/C13H23NO2.ClH/c15-13(12-5-1-2-6-12)16-9-7-11-4-3-8-14-10-11;/h11-12,14H,1-10H2;1H
InChI key:InChIKey=FYRTVPBYONCFNA-UHFFFAOYSA-N
SMILES:C(OCCC1CCCNC1)(=O)C2CCCC2.Cl
Synonyms:- Cyclopentanecarboxylic acid, 2-(3-piperidinyl)ethyl ester, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.