CAS 1219980-91-2

Piperidine, 2-[2-[(2-chlorophenyl)methoxy]ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 2-[2-[(2-chlorophenyl)methoxy]ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a 2-chlorophenyl group attached via a methoxyethyl linker, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The presence of the chlorophenyl moiety may impart specific pharmacological effects, making it of interest in medicinal chemistry. Its structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. Safety and handling precautions should be observed due to the presence of chlorine, which can influence toxicity and environmental impact. Overall, this compound exemplifies the complexity and diversity of piperidine derivatives in chemical research and development.

Formula: C₁₄H₂₀ClNO·ClH

InChI: InChI=1S/C14H20ClNO.ClH/c15-14-7-2-1-5-12(14)11-17-10-8-13-6-3-4-9-16-13;/h1-2,5,7,13,16H,3-4,6,8-11H2;1H

InChI key: InChIKey=GNZFRYWHZWPKHS-UHFFFAOYSA-N

SMILES: C(OCCC1CCCCN1)C2=C(Cl)C=CC=C2.Cl

Synonyms:

• Piperidine, 2-[2-[(2-chlorophenyl)methoxy]ethyl]-, hydrochloride (1:1)