
CAS 1219980-93-4
:Piperidine, 3-[2-(3-methoxypropoxy)ethyl]-, hydrochloride (1:1)
Description:
Piperidine, 3-[2-(3-methoxypropoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a propoxy group with a methoxy substituent, contributing to its solubility and potential biological activity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications, including pharmaceutical formulations. The presence of the methoxy group may enhance its lipophilicity, influencing its pharmacokinetic properties. Piperidine derivatives are often studied for their potential therapeutic effects, including analgesic and anti-inflammatory properties. The compound's molecular interactions, such as hydrogen bonding and hydrophobic interactions, play a crucial role in its biological activity. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or reactivity. Overall, this compound represents a class of piperidine derivatives with promising applications in medicinal chemistry.
Formula:C11H23NO2·ClH
InChI:InChI=1S/C11H23NO2.ClH/c1-13-7-3-8-14-9-5-11-4-2-6-12-10-11;/h11-12H,2-10H2,1H3;1H
InChI key:InChIKey=HRGBUHQQXYDFDL-UHFFFAOYSA-N
SMILES:C(COCCCOC)C1CCCNC1.Cl
Synonyms:- Piperidine, 3-[2-(3-methoxypropoxy)ethyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.