
CAS 1219980-98-9
:Piperidine, 3-[(4-fluorophenyl)methoxy]-, hydrochloride (1:1)
Description:
Piperidine, 3-[(4-fluorophenyl)methoxy]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. The presence of a 4-fluorophenyl group attached via a methoxy linkage at the third position of the piperidine ring contributes to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The fluorine atom in the phenyl group can influence the compound's biological activity and lipophilicity, potentially affecting its pharmacokinetics and pharmacodynamics. This compound may exhibit various biological activities, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, boiling point, and spectral data, would be determined through experimental methods and may vary based on purity and formulation. Safety data should also be consulted to understand handling and toxicity considerations.
Formula:C12H16FNO·ClH
InChI:InChI=1S/C12H16FNO.ClH/c13-11-5-3-10(4-6-11)9-15-12-2-1-7-14-8-12;/h3-6,12,14H,1-2,7-9H2;1H
InChI key:InChIKey=SYUAJBBFHSPWHD-UHFFFAOYSA-N
SMILES:C(OC1CCCNC1)C2=CC=C(F)C=C2.Cl
Synonyms:- Piperidine, 3-[(4-fluorophenyl)methoxy]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.