CymitQuimica logo

CAS 1219981-05-1

:

1-(6-Chloro-2-pyrazinyl)-1,2,3,4-tetrahydroquinoline

Description:
1-(6-Chloro-2-pyrazinyl)-1,2,3,4-tetrahydroquinoline is a chemical compound characterized by its unique structure, which includes a tetrahydroquinoline core fused with a pyrazine ring that is substituted with a chlorine atom. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity due to the presence of nitrogen atoms in its rings. The chloro substituent can influence its reactivity and solubility, making it of interest in medicinal chemistry and drug development. The presence of both the pyrazine and tetrahydroquinoline moieties suggests potential applications in pharmacology, particularly in the development of agents targeting various biological pathways. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and mass spectrometry, aiding in its identification and characterization. Overall, 1-(6-Chloro-2-pyrazinyl)-1,2,3,4-tetrahydroquinoline represents a class of compounds that may possess significant therapeutic potential, warranting further investigation into its properties and applications.
Formula:C13H12ClN3
InChI:InChI=1S/C13H12ClN3/c14-12-8-15-9-13(16-12)17-7-3-5-10-4-1-2-6-11(10)17/h1-2,4,6,8-9H,3,5,7H2
InChI key:InChIKey=HMKDPHITRCSOHW-UHFFFAOYSA-N
SMILES:ClC=1N=C(N2C=3C(CCC2)=CC=CC3)C=NC1
Synonyms:
  • 1-(6-Chloro-2-pyrazinyl)-1,2,3,4-tetrahydroquinoline
  • Quinoline, 1-(6-chloro-2-pyrazinyl)-1,2,3,4-tetrahydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.