
CAS 1219981-06-2
:3-Pyridinecarboxylic acid, 3-piperidinyl ester, hydrochloride (1:1)
Description:
3-Pyridinecarboxylic acid, 3-piperidinyl ester, hydrochloride (1:1) is a chemical compound characterized by its pyridine and piperidine moieties, which contribute to its biological activity and solubility properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of the carboxylic acid group suggests potential for hydrogen bonding, which can influence its interaction with biological targets. This compound may exhibit properties such as being a potential intermediate in organic synthesis or a pharmacologically active agent, depending on its specific structure and functional groups. Its molecular structure allows for various interactions, making it a candidate for further research in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings. As with any compound, its stability, reactivity, and compatibility with other substances should be evaluated in the context of its intended use.
Formula:C11H14N2O2·ClH
InChI:InChI=1S/C11H14N2O2.ClH/c14-11(9-3-1-5-12-7-9)15-10-4-2-6-13-8-10;/h1,3,5,7,10,13H,2,4,6,8H2;1H
InChI key:InChIKey=ZGFBLNATAXQBAF-UHFFFAOYSA-N
SMILES:C(OC1CCCNC1)(=O)C=2C=CC=NC2.Cl
Synonyms:- 3-Pyridinecarboxylic acid, 3-piperidinyl ester, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.