CymitQuimica logo

CAS 1219981-13-1

:

Piperidine, 2-[2-(2-chloro-4-fluorophenoxy)ethyl]-, hydrochloride (1:1)

Description:
Piperidine, 2-[2-(2-chloro-4-fluorophenoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a chloro-fluorophenoxy group, indicating the presence of a phenyl ring substituted with chlorine and fluorine atoms, linked through an ethyl chain to the piperidine structure. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents. The presence of the chloro and fluoro substituents suggests potential biological activity, making it of interest in medicinal chemistry. The compound may exhibit properties such as basicity due to the nitrogen atom in the piperidine ring, and it may participate in various chemical reactions typical of amines and ethers. Its specific applications and effects would depend on further studies, including pharmacological evaluations. Safety data and handling precautions should be observed, as with any chemical substance, particularly those with potential biological activity.
Formula:C13H17ClFNO·ClH
InChI:InChI=1S/C13H17ClFNO.ClH/c14-12-9-10(15)4-5-13(12)17-8-6-11-3-1-2-7-16-11;/h4-5,9,11,16H,1-3,6-8H2;1H
InChI key:InChIKey=ATHGYMXMOMCKAX-UHFFFAOYSA-N
SMILES:O(CCC1CCCCN1)C2=C(Cl)C=C(F)C=C2.Cl
Synonyms:
  • Piperidine, 2-[2-(2-chloro-4-fluorophenoxy)ethyl]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.