CAS 1219981-14-2

4-(6-Chloro-2-pyrazinyl)-1-piperazineethanol

Description:

4-(6-Chloro-2-pyrazinyl)-1-piperazineethanol is a chemical compound characterized by its unique structural features, which include a piperazine ring and a pyrazine moiety. The presence of a chloro substituent on the pyrazine ring contributes to its potential biological activity. This compound typically exhibits properties such as solubility in polar solvents due to the hydroxyl group in the ethanol part of its structure, which can also influence its interaction with biological targets. The piperazine ring is known for its role in pharmacology, often serving as a scaffold for various therapeutic agents. The compound may exhibit various pharmacokinetic properties, including absorption, distribution, metabolism, and excretion, which are crucial for its potential applications in medicinal chemistry. Additionally, the presence of halogen atoms like chlorine can enhance lipophilicity and affect the compound's reactivity. Overall, 4-(6-Chloro-2-pyrazinyl)-1-piperazineethanol represents a class of compounds that may have significant implications in drug development and therapeutic applications.

Formula: C₁₀H₁₅ClN₄O

InChI: InChI=1S/C10H15ClN4O/c11-9-7-12-8-10(13-9)15-3-1-14(2-4-15)5-6-16/h7-8,16H,1-6H2

InChI key: InChIKey=LSZFRYAPZNMKFA-UHFFFAOYSA-N

SMILES: ClC=1N=C(C=NC1)N2CCN(CCO)CC2

Synonyms:

• 2-[4-(6-Chloropyrazin-2-yl)piperazin-1-yl]ethan-1-ol
• 2-[4-(6-Chloropyrazin-2-yl)piperazin-1-yl]ethanol
• 1-Piperazineethanol, 4-(6-chloro-2-pyrazinyl)-
• 4-(6-Chloro-2-pyrazinyl)-1-piperazineethanol
• 2-[4-(6-Chloro-2-pyrazinyl)-1-piperazinyl]-1-ethanol