
CAS 1219981-19-7
:Piperidine, 3-[2-(2-propoxyethoxy)ethyl]-, hydrochloride (1:1)
Description:
Piperidine, 3-[2-(2-propoxyethoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a propoxyethoxy side chain, contributing to its solubility and potential biological activity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications, including pharmaceutical formulations. The presence of the piperidine moiety often indicates potential use in medicinal chemistry, as piperidine derivatives are known for their diverse pharmacological properties. The compound's molecular structure suggests it may interact with biological systems, potentially influencing neurotransmitter pathways or other physiological processes. Safety and handling considerations are essential, as with many organic compounds, and proper laboratory protocols should be followed when working with this substance. Overall, its unique structure and properties make it a subject of interest in both research and application within the field of chemistry and pharmacology.
Formula:C12H25NO2·ClH
InChI:InChI=1S/C12H25NO2.ClH/c1-2-7-14-9-10-15-8-5-12-4-3-6-13-11-12;/h12-13H,2-11H2,1H3;1H
InChI key:InChIKey=ADJPCQWNRHHDLY-UHFFFAOYSA-N
SMILES:C(COCCOCCC)C1CCCNC1.Cl
Synonyms:- Piperidine, 3-[2-(2-propoxyethoxy)ethyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.