
CAS 1219981-28-8
:Pyrrolidine, 3-(2-propoxyethoxy)-, hydrochloride (1:1)
Description:
Pyrrolidine, 3-(2-propoxyethoxy)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered saturated heterocycle containing one nitrogen atom. The presence of the 2-propoxyethoxy group indicates that the compound has an ether functional group, contributing to its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications, including pharmaceutical formulations. The compound may exhibit biological activity, potentially influencing neurotransmitter systems or other physiological pathways, although specific pharmacological properties would require further investigation. Its molecular structure suggests it may participate in hydrogen bonding due to the presence of the ether and amine functionalities, affecting its interaction with biological targets. Safety data and handling precautions should be observed, as with any chemical substance, particularly in laboratory or industrial settings.
Formula:C9H19NO2.ClH
InChI:InChI=1S/C9H19NO2.ClH/c1-2-5-11-6-7-12-9-3-4-10-8-9;/h9-10H,2-8H2,1H3;1H
InChI key:InChIKey=HBSKITBONSNGEU-UHFFFAOYSA-N
SMILES:O(CCOCCC)C1CCNC1.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.