
CAS 1219981-33-5
:Piperidine, 2-[2-(2-bromo-4-methylphenoxy)ethyl]-, hydrochloride (1:1)
Description:
Piperidine, 2-[2-(2-bromo-4-methylphenoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a side chain that includes a bromo-substituted phenyl group, specifically a 4-methylphenoxy moiety, which contributes to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The presence of the bromine atom may impart specific reactivity and influence the compound's interaction with biological targets. Piperidine derivatives are often studied for their roles in medicinal chemistry, as they can exhibit a range of pharmacological effects. Safety and handling precautions should be observed due to the potential toxicity associated with halogenated compounds. Overall, this substance represents a complex structure with potential applications in drug development and research.
Formula:C14H20BrNO·ClH
InChI:InChI=1S/C14H20BrNO.ClH/c1-11-5-6-14(13(15)10-11)17-9-7-12-4-2-3-8-16-12;/h5-6,10,12,16H,2-4,7-9H2,1H3;1H
InChI key:InChIKey=AYAAGRJBGKNZKJ-UHFFFAOYSA-N
SMILES:O(CCC1CCCCN1)C2=C(Br)C=C(C)C=C2.Cl
Synonyms:- Piperidine, 2-[2-(2-bromo-4-methylphenoxy)ethyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.