CymitQuimica logo

CAS 1219981-34-6

:

Quinoline, 1,2,3,4-tetrahydro-1-[2-(4-piperidinyl)ethyl]-, hydrochloride (1:2)

Description:
Quinoline, 1,2,3,4-tetrahydro-1-[2-(4-piperidinyl)ethyl]-, hydrochloride (1:2) is a chemical compound characterized by its complex structure, which includes a quinoline ring fused with a tetrahydro moiety and a piperidine side chain. This compound typically appears as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications, particularly in medicinal chemistry. The presence of the piperidine group suggests potential pharmacological activity, as piperidine derivatives are often associated with various biological effects, including analgesic and anti-inflammatory properties. The compound's molecular structure indicates it may interact with neurotransmitter systems, potentially influencing central nervous system activity. Its synthesis and characterization involve standard organic chemistry techniques, and it may be of interest in research related to drug development or as a chemical probe in biological studies. Safety and handling precautions should be observed, as with any chemical substance, particularly those with potential biological activity.
Formula:C16H24N2.2ClH
InChI:InChI=1S/C16H24N2.2ClH/c1-2-6-16-15(4-1)5-3-12-18(16)13-9-14-7-10-17-11-8-14;;/h1-2,4,6,14,17H,3,5,7-13H2;2*1H
InChI key:InChIKey=BFIGJAMRHADYAI-UHFFFAOYSA-N
SMILES:C(CC1CCNCC1)N2C=3C(CCC2)=CC=CC3.Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.