
CAS 1219981-45-9
:Piperidine, 4-[2-(2-ethoxyphenoxy)ethyl]-, hydrochloride (1:1)
Description:
Piperidine, 4-[2-(2-ethoxyphenoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a substituent that includes a 2-ethoxyphenoxy group, indicating the presence of an ethoxy group attached to a phenyl ring, which is further connected to the piperidine structure via an ethyl linker. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The presence of the hydrochloride indicates that it can exist as a stable, crystalline solid under standard conditions. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its specific properties, such as melting point, solubility, and reactivity, would depend on the precise molecular interactions and the environment in which it is studied.
Formula:C15H23NO2·ClH
InChI:InChI=1S/C15H23NO2.ClH/c1-2-17-14-5-3-4-6-15(14)18-12-9-13-7-10-16-11-8-13;/h3-6,13,16H,2,7-12H2,1H3;1H
InChI key:InChIKey=JSOSLZLYEDXTFK-UHFFFAOYSA-N
SMILES:O(CCC1CCNCC1)C2=C(OCC)C=CC=C2.Cl
Synonyms:- Piperidine, 4-[2-(2-ethoxyphenoxy)ethyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.