
CAS 1219981-49-3
:2-[(6-Chloro-2-pyridinyl)methylamino]ethanol
Description:
2-[(6-Chloro-2-pyridinyl)methylamino]ethanol, identified by its CAS number 1219981-49-3, is a chemical compound characterized by its structural features that include a pyridine ring substituted with a chlorine atom and an amino group linked to an ethanol moiety. This compound typically exhibits properties associated with both amines and alcohols, such as potential solubility in polar solvents due to the hydroxyl group and the ability to participate in hydrogen bonding. The presence of the chloro substituent on the pyridine ring may influence its reactivity and biological activity, potentially making it a candidate for pharmaceutical applications. Additionally, the compound's molecular structure suggests it may have specific interactions with biological targets, which could be relevant in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be of interest in research related to drug development or as a building block in organic synthesis. Safety and handling precautions should be observed due to the presence of chlorine and the potential for biological activity.
Formula:C8H11ClN2O
InChI:InChI=1S/C8H11ClN2O/c1-11(5-6-12)8-4-2-3-7(9)10-8/h2-4,12H,5-6H2,1H3
InChI key:InChIKey=MYUDNTCZDSJQGV-UHFFFAOYSA-N
SMILES:N(CCO)(C)C=1N=C(Cl)C=CC1
Synonyms:- Ethanol, 2-[(6-chloro-2-pyridinyl)methylamino]-
- 2-[(6-Chloro-2-pyridinyl)methylamino]ethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.