CAS 1219981-50-6

Piperidine, 3-[2-(2-ethoxyphenoxy)ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 3-[2-(2-ethoxyphenoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a substituent that includes a 2-ethoxyphenoxy group, indicating the presence of an ethoxy group attached to a phenyl ring, which is further linked to the piperidine structure via an ethyl chain. The hydrochloride designation signifies that the compound is in its salt form, typically enhancing its solubility in water and stability. As a piperidine derivative, it may exhibit properties such as basicity and potential biological activity, making it of interest in medicinal chemistry. The presence of the ethoxyphenoxy group may influence its pharmacological profile, potentially affecting interactions with biological targets. Overall, this compound's unique structure suggests potential applications in drug development or as a research chemical, although specific biological activities and applications would require further investigation.

Formula: C₁₅H₂₃NO₂·ClH

InChI: InChI=1S/C15H23NO2.ClH/c1-2-17-14-7-3-4-8-15(14)18-11-9-13-6-5-10-16-12-13;/h3-4,7-8,13,16H,2,5-6,9-12H2,1H3;1H

InChI key: InChIKey=YLIUMXWVZUMJCO-UHFFFAOYSA-N

SMILES: O(CCC1CCCNC1)C2=C(OCC)C=CC=C2.Cl

Synonyms:

• Piperidine, 3-[2-(2-ethoxyphenoxy)ethyl]-, hydrochloride (1:1)