CymitQuimica logo

CAS 1219981-52-8

:

Pyrrolidine, 3-[[4-(phenylmethoxy)phenoxy]methyl]-, hydrochloride (1:1)

Description:
Pyrrolidine, 3-[[4-(phenylmethoxy)phenoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of the phenylmethoxy and phenoxy groups indicates that this compound has significant aromatic character, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in pharmaceutical applications. The compound may exhibit properties such as being a potential ligand or inhibitor in various biochemical pathways, making it of interest in medicinal chemistry. Its structure suggests that it could interact with biological targets due to the presence of the aromatic rings, which can participate in π-π stacking and hydrophobic interactions. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential pharmacological effects. Further studies would be necessary to elucidate its specific properties, mechanisms of action, and potential applications in research or therapeutics.
Formula:C18H21NO2·ClH
InChI:InChI=1S/C18H21NO2.ClH/c1-2-4-15(5-3-1)13-20-17-6-8-18(9-7-17)21-14-16-10-11-19-12-16;/h1-9,16,19H,10-14H2;1H
InChI key:InChIKey=JNZNEIHBHCKCGO-UHFFFAOYSA-N
SMILES:O(CC1CCNC1)C2=CC=C(OCC3=CC=CC=C3)C=C2.Cl
Synonyms:
  • Pyrrolidine, 3-[[4-(phenylmethoxy)phenoxy]methyl]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.