CAS 1219982-04-3

Piperidine, 2-[2-(2-methoxyphenoxy)ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 2-[2-(2-methoxyphenoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing ring. This compound features a 2-(2-methoxyphenoxy)ethyl substituent, indicating the presence of a methoxy group attached to a phenyl ring, which is further linked to an ethyl chain. The hydrochloride form suggests that the compound is a salt, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The presence of the piperidine moiety often imparts biological activity, as piperidine derivatives are known for their roles in medicinal chemistry, including potential effects on the central nervous system. The compound's molecular structure contributes to its pharmacological properties, which may include analgesic, anti-inflammatory, or other therapeutic effects. As with many piperidine derivatives, it is essential to consider safety and handling protocols due to potential toxicity and reactivity.

Formula: C₁₄H₂₁NO₂·ClH

InChI: InChI=1S/C14H21NO2.ClH/c1-16-13-7-2-3-8-14(13)17-11-9-12-6-4-5-10-15-12;/h2-3,7-8,12,15H,4-6,9-11H2,1H3;1H

InChI key: InChIKey=JCMXLBRGOMIDIB-UHFFFAOYSA-N

SMILES: O(CCC1CCCCN1)C2=C(OC)C=CC=C2.Cl

Synonyms:

• Piperidine, 2-[2-(2-methoxyphenoxy)ethyl]-, hydrochloride (1:1)