
CAS 1219982-05-4
:Piperidine, 3-[2-(1,1-dimethylethyl)phenoxy]-, hydrochloride (1:1)
Description:
Piperidine, 3-[2-(1,1-dimethylethyl)phenoxy]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. The compound features a phenoxy group substituted with a tert-butyl group, contributing to its hydrophobic characteristics and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of the piperidine moiety suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The compound may exhibit properties such as basicity due to the nitrogen atom in the piperidine ring, and it may participate in hydrogen bonding due to the presence of functional groups. Its specific applications and effects would depend on its interaction with biological systems, which could include roles in neurotransmission or other physiological processes. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential pharmacological activity.
Formula:C15H23NO·ClH
InChI:InChI=1S/C15H23NO.ClH/c1-15(2,3)13-8-4-5-9-14(13)17-12-7-6-10-16-11-12;/h4-5,8-9,12,16H,6-7,10-11H2,1-3H3;1H
InChI key:InChIKey=UTGHRKQLIVAFPX-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C1=C(OC2CCCNC2)C=CC=C1.Cl
Synonyms:- Piperidine, 3-[2-(1,1-dimethylethyl)phenoxy]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.