
CAS 1219982-12-3
:Piperidine, 2-[2-[2-(trifluoromethyl)phenoxy]ethyl]-, hydrochloride (1:1)
Description:
Piperidine, 2-[2-[2-(trifluoromethyl)phenoxy]ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a trifluoromethyl group attached to a phenoxyethyl side chain, enhancing its lipophilicity and potentially influencing its biological activity. The hydrochloride form indicates that the compound is a salt, which typically improves its solubility in water and stability. As a piperidine derivative, it may exhibit properties relevant to medicinal chemistry, including potential applications in pharmaceuticals. The presence of the trifluoromethyl group often contributes to increased metabolic stability and altered pharmacokinetics. The compound's structure suggests it may interact with various biological targets, making it of interest in drug discovery and development. However, specific biological activities, toxicity, and safety profiles would require further investigation through empirical studies.
Formula:C14H18F3NO·ClH
InChI:InChI=1S/C14H18F3NO.ClH/c15-14(16,17)12-6-1-2-7-13(12)19-10-8-11-5-3-4-9-18-11;/h1-2,6-7,11,18H,3-5,8-10H2;1H
InChI key:InChIKey=RXKDZAYYCUUSRR-UHFFFAOYSA-N
SMILES:O(CCC1CCCCN1)C2=C(C(F)(F)F)C=CC=C2.Cl
Synonyms:- Piperidine, 2-[2-[2-(trifluoromethyl)phenoxy]ethyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.