CAS 1219982-14-5

Piperidine, 3-[2-methyl-5-(1-methylethyl)phenoxy]-, hydrochloride (1:1)

Description:

Piperidine, 3-[2-methyl-5-(1-methylethyl)phenoxy]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. This compound features a phenoxy group substituted with a branched alkyl chain, specifically a 2-methyl-5-(1-methylethyl)phenyl moiety, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the piperidine structure often indicates potential biological activity, making it of interest in medicinal chemistry. The compound may exhibit properties such as being a potential ligand for various receptors or enzymes, and its specific interactions would depend on the substituents and their spatial arrangement. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Further studies would be necessary to fully elucidate its pharmacological profile and potential applications.

Formula: C₁₅H₂₃NO·ClH

InChI: InChI=1S/C15H23NO.ClH/c1-11(2)13-7-6-12(3)15(9-13)17-14-5-4-8-16-10-14;/h6-7,9,11,14,16H,4-5,8,10H2,1-3H3;1H

InChI key: InChIKey=QRKCECLXUSBAFU-UHFFFAOYSA-N

SMILES: O(C1=CC(C(C)C)=CC=C1C)C2CCCNC2.Cl

Synonyms:

• Piperidine, 3-[2-methyl-5-(1-methylethyl)phenoxy]-, hydrochloride (1:1)