CAS 1219982-15-6: 3-(2,3-Dimethylphenoxy)azetidine

Description:3-(2,3-Dimethylphenoxy)azetidine is a chemical compound characterized by its azetidine ring, which is a four-membered saturated heterocyclic structure containing one nitrogen atom. The presence of the 2,3-dimethylphenoxy group indicates that the compound has a phenolic moiety with two methyl substituents on the aromatic ring, contributing to its hydrophobic characteristics. This compound may exhibit interesting biological activities due to its unique structure, potentially influencing its interactions with biological targets. The azetidine ring can impart strain, which may affect the compound's reactivity and stability. Additionally, the presence of the phenoxy group can enhance solubility in organic solvents and may influence the compound's overall polarity. As with many organic compounds, the specific physical properties such as melting point, boiling point, and solubility would depend on the molecular interactions and the environment in which the compound is studied. Overall, 3-(2,3-Dimethylphenoxy)azetidine represents a class of compounds that may have applications in medicinal chemistry and material science.

Formula:C₁₁H₁₅NO

InChI:InChI=1S/C11H15NO/c1-8-4-3-5-11(9(8)2)13-10-6-12-7-10/h3-5,10,12H,6-7H2,1-2H3

InChI key:InChIKey=KACHZCLSILCLRU-UHFFFAOYSA-N

SMILES:O(C1=CC=CC(=C1C)C)C2CNC2

Synonyms:
Azetidine, 3-(2,3-dimethylphenoxy)-
3-(2,3-Dimethylphenoxy)azetidine

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	3-(2,3-Dimethylphenoxy)azetidine REF: 10-F687073CAS: 1219982-15-6	98%	- - -	Discontinued product
	3-(2,3-Dimethylphenoxy)azetidine REF: 3D-UYB98215CAS: 1219982-15-6	Min. 95%	- - -	Discontinued product