CAS 1219982-22-5

Pyrrolidine, 3-[(2,4-dimethylphenoxy)methyl]-, hydrochloride (1:1)

Description:

Pyrrolidine, 3-[(2,4-dimethylphenoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of a 2,4-dimethylphenoxy group indicates that the compound has a phenolic structure with two methyl substituents on the aromatic ring, contributing to its hydrophobic characteristics. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its bioavailability for pharmaceutical applications. The compound may exhibit various biological activities, potentially including effects on the central nervous system, due to the presence of the pyrrolidine moiety, which is often associated with neurotransmitter modulation. Its specific properties, such as melting point, boiling point, and spectral characteristics, would depend on the molecular interactions and the presence of the hydrochloride group. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory or industrial settings.

Formula: C₁₃H₁₉NO·ClH

InChI: InChI=1S/C13H19NO.ClH/c1-10-3-4-13(11(2)7-10)15-9-12-5-6-14-8-12;/h3-4,7,12,14H,5-6,8-9H2,1-2H3;1H

InChI key: InChIKey=VXHLBNQVNYJPES-UHFFFAOYSA-N

SMILES: O(CC1CCNC1)C2=C(C)C=C(C)C=C2.Cl

Synonyms:

• Pyrrolidine, 3-[(2,4-dimethylphenoxy)methyl]-, hydrochloride (1:1)