CAS 1219982-24-7

Acetamide, N-ethyl-N-(2-hydroxyethyl)-2-(methylamino)-, hydrochloride (1:1)

Description:

Acetamide, N-ethyl-N-(2-hydroxyethyl)-2-(methylamino)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is indicative of its potential as a polar solvent and its ability to participate in hydrogen bonding. This compound features an ethyl group and a hydroxyethyl group, contributing to its solubility in polar solvents, while the methylamino group enhances its basicity and reactivity. The hydrochloride form suggests that it is a salt, which typically increases its stability and solubility in aqueous solutions. This compound may exhibit biological activity, making it of interest in pharmaceutical applications. Its molecular structure allows for various interactions, including potential hydrogen bonding and dipole-dipole interactions, which can influence its behavior in biological systems. Additionally, the presence of the hydrochloride indicates that it can dissociate in solution, releasing protons and affecting the pH of the environment. Overall, this compound's unique structural features and properties make it a subject of interest in both synthetic and medicinal chemistry.

Formula: C₇H₁₆N₂O₂·ClH

InChI: InChI=1S/C7H16N2O2.ClH/c1-3-9(4-5-10)7(11)6-8-2;/h8,10H,3-6H2,1-2H3;1H

InChI key: InChIKey=WMQMXQBPWKJELE-UHFFFAOYSA-N

SMILES: N(C(CNC)=O)(CCO)CC.Cl

Synonyms:

• Acetamide, N-ethyl-N-(2-hydroxyethyl)-2-(methylamino)-, hydrochloride (1:1)