CAS 1219982-29-2

Piperidine, 4-[2-(4-propylphenoxy)ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 4-[2-(4-propylphenoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a propylphenoxyethyl side chain, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The presence of the piperidine moiety suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its structure may influence its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion. Additionally, the compound may exhibit specific reactivity patterns due to the functional groups present, which could be relevant in synthetic chemistry or drug development. Overall, this compound's characteristics make it a subject of interest for further research in the fields of organic chemistry and pharmacology.

Formula: C₁₆H₂₅NO·ClH

InChI: InChI=1S/C16H25NO.ClH/c1-2-3-14-4-6-16(7-5-14)18-13-10-15-8-11-17-12-9-15;/h4-7,15,17H,2-3,8-13H2,1H3;1H

InChI key: InChIKey=QSWIOWLVGNBBGS-UHFFFAOYSA-N

SMILES: O(CCC1CCNCC1)C2=CC=C(CCC)C=C2.Cl

Synonyms:

• Piperidine, 4-[2-(4-propylphenoxy)ethyl]-, hydrochloride (1:1)