CAS 1219982-32-7

Piperidine, 2-[2-(2,5-dimethylphenoxy)ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 2-[2-(2,5-dimethylphenoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a 2-(2,5-dimethylphenoxy)ethyl substituent, indicating the presence of a phenoxy group attached to an ethyl chain, which contributes to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the dimethyl groups on the phenyl ring may influence its lipophilicity and interaction with biological targets. This compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through experimental studies and literature review.

Formula: C₁₅H₂₃NO·ClH

InChI: InChI=1S/C15H23NO.ClH/c1-12-6-7-13(2)15(11-12)17-10-8-14-5-3-4-9-16-14;/h6-7,11,14,16H,3-5,8-10H2,1-2H3;1H

InChI key: InChIKey=BTKVNULMGVSVPV-UHFFFAOYSA-N

SMILES: O(CCC1CCCCN1)C2=C(C)C=CC(C)=C2.Cl

Synonyms:

• Piperidine, 2-[2-(2,5-dimethylphenoxy)ethyl]-, hydrochloride (1:1)