CAS 1219982-33-8

3-(2,4-Dichloro-3,5-dimethylphenoxy)azetidine

Description:

3-(2,4-Dichloro-3,5-dimethylphenoxy)azetidine is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The compound features a phenoxy group substituted with two chlorine atoms and two methyl groups, contributing to its unique chemical properties. The presence of the dichloro and dimethyl substituents on the phenyl ring enhances its lipophilicity and may influence its biological activity. This compound is likely to exhibit moderate to high stability under standard conditions, although its reactivity can be influenced by the functional groups present. It may also demonstrate specific interactions with biological targets, making it of interest in pharmaceutical research. As with many organic compounds, its solubility, melting point, and other physical properties would depend on the specific conditions and solvents used. Safety data should be consulted for handling and potential hazards associated with this compound, as halogenated compounds can exhibit toxicity and environmental persistence.

Formula: C₁₁H₁₃Cl₂NO

InChI: InChI=1S/C11H13Cl2NO/c1-6-3-9(15-8-4-14-5-8)11(13)7(2)10(6)12/h3,8,14H,4-5H2,1-2H3

InChI key: InChIKey=RSHOQUOVTPRJNM-UHFFFAOYSA-N

SMILES: O(C1=C(Cl)C(C)=C(Cl)C(C)=C1)C2CNC2

Synonyms:

• 3-(2,4-Dichloro-3,5-dimethylphenoxy)azetidine
• Azetidine, 3-(2,4-dichloro-3,5-dimethylphenoxy)-