CAS 1219982-45-2

Pyrrolidine, 3-[(3,4-difluorophenoxy)methyl]-, hydrochloride (1:1)

Description:

Pyrrolidine, 3-[(3,4-difluorophenoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of a 3,4-difluorophenoxy group indicates that the compound has significant fluorine substitution, which can influence its chemical reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The compound may exhibit properties such as potential neuroactivity or other pharmacological effects, making it of interest in medicinal chemistry. Its molecular structure suggests that it could interact with various biological targets, possibly influencing neurotransmitter systems or other physiological pathways. Safety and handling considerations are essential, as with many chemical substances, particularly those with potential biological activity. Proper storage conditions and adherence to safety protocols are crucial when working with this compound in a laboratory setting.

Formula: C₁₁H₁₃F₂NO·ClH

InChI: InChI=1S/C11H13F2NO.ClH/c12-10-2-1-9(5-11(10)13)15-7-8-3-4-14-6-8;/h1-2,5,8,14H,3-4,6-7H2;1H

InChI key: InChIKey=POFIWFOPTLWGLT-UHFFFAOYSA-N

SMILES: O(CC1CCNC1)C2=CC(F)=C(F)C=C2.Cl

Synonyms:

• Pyrrolidine, 3-[(3,4-difluorophenoxy)methyl]-, hydrochloride (1:1)