CymitQuimica logo

CAS 1219982-46-3

:

Methanone, (hexahydro-1H-azepin-1-yl)(4,5,6,7-tetrahydro-1H-pyrazolo[4,3-c]pyridin-3-yl)-, hydrochloride (1:1)

Description:
Methanone, (hexahydro-1H-azepin-1-yl)(4,5,6,7-tetrahydro-1H-pyrazolo[4,3-c]pyridin-3-yl)-, hydrochloride (1:1), identified by CAS number 1219982-46-3, is a chemical compound characterized by its complex molecular structure, which includes a hexahydro-azepine moiety and a tetrahydro-pyrazolo-pyridine component. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its pharmacological properties. The presence of multiple heterocyclic rings suggests potential biological activity, making it of interest in medicinal chemistry. Its structural features may contribute to interactions with biological targets, potentially leading to therapeutic applications. As with many organic compounds, its stability, reactivity, and solubility can vary based on environmental conditions such as pH and temperature. Safety data and handling precautions should be adhered to, as with all chemical substances, to mitigate any risks associated with its use in research or pharmaceutical development.
Formula:C13H20N4O·ClH
InChI:InChI=1S/C13H20N4O.ClH/c18-13(17-7-3-1-2-4-8-17)12-10-9-14-6-5-11(10)15-16-12;/h14H,1-9H2,(H,15,16);1H
InChI key:InChIKey=GYUBIJBOWPPAAV-UHFFFAOYSA-N
SMILES:C(=O)(C=1C2=C(NN1)CCNC2)N3CCCCCC3.Cl
Synonyms:
  • Methanone, (hexahydro-1H-azepin-1-yl)(4,5,6,7-tetrahydro-1H-pyrazolo[4,3-c]pyridin-3-yl)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.