CAS 1219982-49-6

Pyridine, 3-(3-pyrrolidinyloxy)-, hydrochloride (1:1)

Description:

Pyridine, 3-(3-pyrrolidinyloxy)-, hydrochloride (1:1) is a chemical compound characterized by its pyridine and pyrrolidine moieties, which contribute to its unique properties. As a hydrochloride salt, it is typically a white to off-white crystalline solid that is soluble in water and polar organic solvents. The presence of the pyrrolidinyloxy group enhances its potential for biological activity, making it of interest in medicinal chemistry and pharmacology. This compound may exhibit various pharmacological effects, including potential neuroactive properties, due to the structural features that allow it to interact with biological targets. Its hydrochloride form indicates that it is a protonated species, which can influence its stability, solubility, and reactivity. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, this compound represents a class of heterocyclic compounds with diverse applications in research and industry.

Formula: C₉H₁₂N₂O·ClH

InChI: InChI=1S/C9H12N2O.ClH/c1-2-8(6-10-4-1)12-9-3-5-11-7-9;/h1-2,4,6,9,11H,3,5,7H2;1H

InChI key: InChIKey=LHDDKSUOMSFDRU-UHFFFAOYSA-N

SMILES: O(C=1C=CC=NC1)C2CCNC2.Cl

Synonyms:

• Pyridine, 3-(3-pyrrolidinyloxy)-, hydrochloride (1:1)