CymitQuimica logo

CAS 1219982-54-3

:

3-(2-Bromo-4-methylphenoxy)azetidine

Description:
3-(2-Bromo-4-methylphenoxy)azetidine is a chemical compound characterized by its azetidine ring, which is a four-membered saturated heterocyclic structure containing one nitrogen atom. The presence of the 2-bromo-4-methylphenoxy group indicates that the compound has a bromine atom and a methyl group attached to a phenyl ring, contributing to its unique reactivity and potential biological activity. This compound may exhibit properties such as moderate solubility in organic solvents and potential interactions with biological targets due to the presence of the phenoxy group. The bromine substituent can enhance the compound's lipophilicity and may influence its pharmacokinetic properties. Additionally, the azetidine ring can participate in various chemical reactions, making it a versatile building block in organic synthesis. Overall, 3-(2-Bromo-4-methylphenoxy)azetidine is of interest in medicinal chemistry and materials science, although specific applications would depend on further research into its biological activity and chemical behavior.
Formula:C10H12BrNO
InChI:InChI=1S/C10H12BrNO/c1-7-2-3-10(9(11)4-7)13-8-5-12-6-8/h2-4,8,12H,5-6H2,1H3
InChI key:InChIKey=FLUDJSSWONWTKJ-UHFFFAOYSA-N
SMILES:O(C1=C(Br)C=C(C)C=C1)C2CNC2
Synonyms:
  • Azetidine, 3-(2-bromo-4-methylphenoxy)-
  • 3-(2-Bromo-4-methylphenoxy)azetidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.