
CAS 1219982-58-7
:Piperidine, 3-[(2-bromo-4-fluorophenoxy)methyl]-, hydrochloride (1:1)
Description:
Piperidine, 3-[(2-bromo-4-fluorophenoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a substituent at the 3-position of the piperidine ring, specifically a 2-bromo-4-fluorophenoxy group, which contributes to its unique chemical properties and potential biological activity. The presence of the hydrochloride indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, including pharmaceutical formulations. The bromine and fluorine substituents on the phenoxy group may influence the compound's reactivity, lipophilicity, and interaction with biological targets. As with many piperidine derivatives, this compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and drug development. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity.
Formula:C12H15BrFNO·ClH
InChI:InChI=1S/C12H15BrFNO.ClH/c13-11-6-10(14)3-4-12(11)16-8-9-2-1-5-15-7-9;/h3-4,6,9,15H,1-2,5,7-8H2;1H
InChI key:InChIKey=BBEFZWHWVZUOSY-UHFFFAOYSA-N
SMILES:O(CC1CCCNC1)C2=C(Br)C=C(F)C=C2.Cl
Synonyms:- Piperidine, 3-[(2-bromo-4-fluorophenoxy)methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.