
CAS 1219982-60-1
:Piperidine, 4-[2-[2-bromo-4-(phenylmethyl)phenoxy]ethyl]-, hydrochloride (1:1)
Description:
Piperidine, 4-[2-[2-bromo-4-(phenylmethyl)phenoxy]ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a bromo-substituted phenyl group linked through an ethyl chain to the piperidine nitrogen, along with a phenoxy group, which contributes to its overall structure and reactivity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including medicinal chemistry. The presence of the bromine atom may impart specific reactivity, making it a potential candidate for further chemical modifications. The compound's molecular interactions, including hydrogen bonding and hydrophobic effects, can influence its biological activity and pharmacokinetics. Overall, this substance may be of interest in research related to pharmaceuticals, particularly in the development of compounds with potential therapeutic effects.
Formula:C20H24BrNO·ClH
InChI:InChI=1S/C20H24BrNO.ClH/c21-19-15-18(14-17-4-2-1-3-5-17)6-7-20(19)23-13-10-16-8-11-22-12-9-16;/h1-7,15-16,22H,8-14H2;1H
InChI key:InChIKey=KWQAGZDSODIRHW-UHFFFAOYSA-N
SMILES:C(C1=CC(Br)=C(OCCC2CCNCC2)C=C1)C3=CC=CC=C3.Cl
Synonyms:- Piperidine, 4-[2-[2-bromo-4-(phenylmethyl)phenoxy]ethyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.