CAS 1219982-66-7

Quinoline, 8-[2-(4-piperidinyl)ethoxy]-, hydrochloride (1:1)

Description:

Quinoline, 8-[2-(4-piperidinyl)ethoxy]-, hydrochloride (1:1) is a chemical compound characterized by its quinoline backbone, which is a bicyclic aromatic compound known for its heterocyclic structure. The presence of a piperidine moiety indicates that it has potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The hydrochloride salt form suggests enhanced solubility in aqueous environments, making it suitable for various formulations. This compound may exhibit properties such as antimicrobial, anti-inflammatory, or analgesic activities, typical of many quinoline derivatives. Its molecular structure allows for potential interactions with neurotransmitter systems, which could be relevant in the context of neurological studies. As with many chemical substances, safety and handling precautions are essential, given the potential for toxicity or adverse effects. Overall, this compound represents a class of chemicals that are of interest in both research and therapeutic applications.

Formula: C₁₆H₂₀N₂O·ClH

InChI: InChI=1S/C16H20N2O.ClH/c1-3-14-4-2-9-18-16(14)15(5-1)19-12-8-13-6-10-17-11-7-13;/h1-5,9,13,17H,6-8,10-12H2;1H

InChI key: InChIKey=QMUKXRBUSAFIFE-UHFFFAOYSA-N

SMILES: O(CCC1CCNCC1)C=2C3=C(C=CC2)C=CC=N3.Cl

Synonyms:

• Quinoline, 8-[2-(4-piperidinyl)ethoxy]-, hydrochloride (1:1)