CAS 1219982-70-3

5-Bromo-3-methyl-N-propyl-2-pyridinamine

Description:

5-Bromo-3-methyl-N-propyl-2-pyridinamine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 5-position and a methyl group at the 3-position of the pyridine ring contributes to its unique chemical properties. The N-propyl substituent indicates that there is a propyl group attached to the nitrogen atom, which can influence the compound's solubility and reactivity. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structure suggests potential interactions with biological targets, possibly affecting enzyme activity or receptor binding. The presence of halogens, such as bromine, often enhances the compound's reactivity, making it suitable for further chemical modifications. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the environment in which it is studied. Overall, 5-Bromo-3-methyl-N-propyl-2-pyridinamine is a versatile compound with potential applications in various fields of chemistry and pharmacology.

Formula: C₉H₁₃BrN₂

InChI: InChI=1S/C9H13BrN2/c1-3-4-11-9-7(2)5-8(10)6-12-9/h5-6H,3-4H2,1-2H3,(H,11,12)

InChI key: InChIKey=QUXJXXLPHPBJDL-UHFFFAOYSA-N

SMILES: N(CCC)C1=C(C)C=C(Br)C=N1

Synonyms:

• 2-Pyridinamine, 5-bromo-3-methyl-N-propyl-
• 5-Bromo-3-methyl-N-propyl-2-pyridinamine