CymitQuimica logo

CAS 1219982-77-0

:

2-[(5-Bromo-3-methyl-2-pyridinyl)amino]ethanol

Description:
2-[(5-Bromo-3-methyl-2-pyridinyl)amino]ethanol is an organic compound characterized by its structure, which includes a pyridine ring substituted with a bromine atom and a methyl group, along with an amino group linked to an ethanol moiety. This compound typically exhibits properties associated with both amines and alcohols, such as potential solubility in polar solvents due to the hydroxyl group and the ability to participate in hydrogen bonding. The presence of the bromine atom may impart specific reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the pyridine ring contributes to the compound's aromatic character, which can influence its electronic properties and stability. This compound may find applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of bromine, which can be hazardous.
Formula:C8H11BrN2O
InChI:InChI=1S/C8H11BrN2O/c1-6-4-7(9)5-11-8(6)10-2-3-12/h4-5,12H,2-3H2,1H3,(H,10,11)
InChI key:InChIKey=OMNMRONWZSZONX-UHFFFAOYSA-N
SMILES:N(CCO)C1=C(C)C=C(Br)C=N1
Synonyms:
  • Ethanol, 2-[(5-bromo-3-methyl-2-pyridinyl)amino]-
  • 2-[(5-Bromo-3-methyl-2-pyridinyl)amino]ethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.