CAS 1219982-78-1

Piperidine, 3-[2-(3-ethoxyphenoxy)ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 3-[2-(3-ethoxyphenoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. This compound features a side chain that includes a 3-ethoxyphenoxy group, indicating the presence of an ethoxy group attached to a phenyl ring, which is further connected to the piperidine structure via an ethyl linker. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the hydrochloride indicates that it can form ionic bonds, which may influence its biological activity and pharmacokinetics. The compound may exhibit properties such as being a potential ligand for various receptors or enzymes, making it of interest in medicinal chemistry. However, specific biological activities, toxicity, and therapeutic applications would require further investigation through empirical studies.

Formula: C₁₅H₂₃NO₂·ClH

InChI: InChI=1S/C15H23NO2.ClH/c1-2-17-14-6-3-7-15(11-14)18-10-8-13-5-4-9-16-12-13;/h3,6-7,11,13,16H,2,4-5,8-10,12H2,1H3;1H

InChI key: InChIKey=BCCIHQXRYGIVCR-UHFFFAOYSA-N

SMILES: O(CCC1CCCNC1)C2=CC(OCC)=CC=C2.Cl

Synonyms:

• Piperidine, 3-[2-(3-ethoxyphenoxy)ethyl]-, hydrochloride (1:1)