
CAS 1219982-79-2
:Pyrrolidine, 3-[(4-bromophenoxy)methyl]-, hydrochloride (1:1)
Description:
Pyrrolidine, 3-[(4-bromophenoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of the 4-bromophenoxy group indicates that a bromine atom is substituted on the phenyl ring, contributing to the compound's unique properties, including potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The compound may exhibit properties such as moderate to high polarity due to the presence of both the amine and ether functionalities. Its structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with many halogenated organic compounds, due to potential toxicity and environmental impact. Overall, this compound's characteristics make it a subject of interest for further research in drug development and related fields.
Formula:C11H14BrNO·ClH
InChI:InChI=1S/C11H14BrNO.ClH/c12-10-1-3-11(4-2-10)14-8-9-5-6-13-7-9;/h1-4,9,13H,5-8H2;1H
InChI key:InChIKey=ZPXDJRWTZAOYFR-UHFFFAOYSA-N
SMILES:O(CC1CCNC1)C2=CC=C(Br)C=C2.Cl
Synonyms:- Pyrrolidine, 3-[(4-bromophenoxy)methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.