CAS 1219982-92-9

Pyrrolidine, 3-[(4-nitrophenoxy)methyl]-, hydrochloride (1:1)

Description:

Pyrrolidine, 3-[(4-nitrophenoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of a 4-nitrophenoxy group attached to the pyrrolidine ring contributes to its unique properties, including potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The compound may exhibit specific pharmacological effects due to the nitro group, which can influence its reactivity and interaction with biological targets. Its molecular structure suggests potential uses in medicinal chemistry, particularly in the development of drugs targeting neurological or other disorders. Safety and handling precautions should be observed, as with all chemical substances, particularly those with nitro groups, which can be sensitive to reduction reactions. Overall, this compound represents a class of substances that may have significant implications in research and therapeutic contexts.

Formula: C₁₁H₁₄N₂O₃·ClH

InChI: InChI=1S/C11H14N2O3.ClH/c14-13(15)10-1-3-11(4-2-10)16-8-9-5-6-12-7-9;/h1-4,9,12H,5-8H2;1H

InChI key: InChIKey=QLNIUYUTSLAVKP-UHFFFAOYSA-N

SMILES: O(CC1CCNC1)C2=CC=C(N(=O)=O)C=C2.Cl

Synonyms:

• Pyrrolidine, 3-[(4-nitrophenoxy)methyl]-, hydrochloride (1:1)