CAS 1219982-98-5

Piperidine, 2-[2-(2,4-difluorophenoxy)ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 2-[2-(2,4-difluorophenoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The compound features a 2-(2,4-difluorophenoxy)ethyl substituent, indicating the presence of a difluorophenyl group attached via an ether linkage to an ethyl chain. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The difluorophenoxy group may impart specific biological activities, making this compound of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, and the presence of fluorine atoms can influence its pharmacokinetic properties, such as lipophilicity and metabolic stability. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.

Formula: C₁₃H₁₇F₂NO·ClH

InChI: InChI=1S/C13H17F2NO.ClH/c14-10-4-5-13(12(15)9-10)17-8-6-11-3-1-2-7-16-11;/h4-5,9,11,16H,1-3,6-8H2;1H

InChI key: InChIKey=LXAZKKPXBXGDCR-UHFFFAOYSA-N

SMILES: O(CCC1CCCCN1)C2=C(F)C=C(F)C=C2.Cl

Synonyms:

• Piperidine, 2-[2-(2,4-difluorophenoxy)ethyl]-, hydrochloride (1:1)